C18H24O5S — CID 117069694
[(3'aS,6'aS)-2'-methylspiro[1,3-dioxolane-2,4'-2,3,3a,5,6,6a-hexahydro-1H-pentalene]-1'-yl] 4-methylbenzenesulfonate (PubChem CID 117069694) has the molecular formula C18H24O5S and a molecular weight of 352.45 g/mol. Its IUPAC name is [(3'aS,6'aS)-2'-methylspiro[1,3-dioxolane-2,4'-2,3,3a,5,6,6a-hexahydro-1H-pentalene]-1'-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3'aS,6'aS)-2'-methylspiro[1,3-dioxolane-2,4'-2,3,3a,5,6,6a-hexahydro-1H-pentalene]-1'-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 117069694 |
| Molecular Formula | C18H24O5S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | [(3'aS,6'aS)-2'-methylspiro[1,3-dioxolane-2,4'-2,3,3a,5,6,6a-hexahydro-1H-pentalene]-1'-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2C(C)C[C@H]3[C@@H]2CCC32OCCO2)cc1 |
| InChI | InChI=1S/C18H24O5S/c1-12-3-5-14(6-4-12)24(19,20)23-17-13(2)11-16-15(17)7-8-18(16)21-9-10-22-18/h3-6,13,15-17H,7-11H2,1-2H3/t13?,15-,16-,17?/m0/s1 |
| InChIKey | JFLAOVOCSDIJQI-DBGUYSSFSA-N |
| XLogP | 2.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|