C18H24O4S — CID 101021783
[(2R,3R)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 4-ethenylbenzenesulfonate (PubChem CID 101021783) has the molecular formula C18H24O4S and a molecular weight of 336.45 g/mol. Its IUPAC name is [(2R,3R)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 4-ethenylbenzenesulfonate.
| Compound Name | [(2R,3R)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 4-ethenylbenzenesulfonate |
|---|---|
| PubChem CID | 101021783 |
| Molecular Formula | C18H24O4S |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | [(2R,3R)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 4-ethenylbenzenesulfonate |
| SMILES | C=Cc1ccc(S(=O)(=O)O[C@@H]2CC3CC(C3(C)C)[C@@]2(C)O)cc1 |
| InChI | InChI=1S/C18H24O4S/c1-5-12-6-8-14(9-7-12)23(20,21)22-16-11-13-10-15(17(13,2)3)18(16,4)19/h5-9,13,15-16,19H,1,10-11H2,2-4H3/t13?,15?,16-,18-/m1/s1 |
| InChIKey | NGBRMKMAFIDKHM-FDNMGUDYSA-N |
| XLogP | 3.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|