C14H13NO6S — CID 173083981
(1,2-diformyl-6-oxo-2,3-dihydropyridin-4-yl) 4-methylbenzenesulfonate (PubChem CID 173083981) has the molecular formula C14H13NO6S and a molecular weight of 323.33 g/mol. Its IUPAC name is (1,2-diformyl-6-oxo-2,3-dihydropyridin-4-yl) 4-methylbenzenesulfonate.
| Compound Name | (1,2-diformyl-6-oxo-2,3-dihydropyridin-4-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 173083981 |
| Molecular Formula | C14H13NO6S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | (1,2-diformyl-6-oxo-2,3-dihydropyridin-4-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2=CC(=O)N(C=O)C(C=O)C2)cc1 |
| InChI | InChI=1S/C14H13NO6S/c1-10-2-4-13(5-3-10)22(19,20)21-12-6-11(8-16)15(9-17)14(18)7-12/h2-5,7-9,11H,6H2,1H3 |
| InChIKey | SWHNMQCJYZSVSO-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|