About cyclopenten-1-yl 4-methylbenzenesulfonate
cyclopenten-1-yl 4-methylbenzenesulfonate (PubChem CID 54481545) has the molecular formula C12H14O3S
and a molecular weight of 238.31 g/mol. Its IUPAC name is cyclopenten-1-yl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | cyclopenten-1-yl 4-methylbenzenesulfonate |
| PubChem CID | 54481545 |
| Molecular Formula | C12H14O3S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | cyclopenten-1-yl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2=CCCC2)cc1 |
| InChI | InChI=1S/C12H14O3S/c1-10-6-8-12(9-7-10)16(13,14)15-11-4-2-3-5-11/h4,6-9H,2-3,5H2,1H3 |
| InChIKey | XPIFIVKHHDZWFH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze cyclopenten-1-yl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenten-1-yl 4-methylbenzenesulfonate?
The IUPAC name of cyclopenten-1-yl 4-methylbenzenesulfonate (CID 54481545) is cyclopenten-1-yl 4-methylbenzenesulfonate.
What is the SMILES notation for cyclopenten-1-yl 4-methylbenzenesulfonate?
The canonical SMILES for cyclopenten-1-yl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OC2=CCCC2)cc1.
What is the InChIKey of cyclopenten-1-yl 4-methylbenzenesulfonate?
The InChIKey is XPIFIVKHHDZWFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3S/c1-10-6-8-12(9-7-10)16(13,14)15-11-4-2-3-5-11/h4,6-9H,2-3,5H2,1H3.
What are the key properties of cyclopenten-1-yl 4-methylbenzenesulfonate?
cyclopenten-1-yl 4-methylbenzenesulfonate has a molecular weight of 238.31 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenten-1-yl 4-methylbenzenesulfonate is sourced from PubChem (CID 54481545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).