C19H28O2S — CID 134942172
(1Z)-1-(4-methylphenyl)sulfonylcyclododecene (PubChem CID 134942172) has the molecular formula C19H28O2S and a molecular weight of 320.50 g/mol. Its IUPAC name is (1Z)-1-(4-methylphenyl)sulfonylcyclododecene.
| Compound Name | (1Z)-1-(4-methylphenyl)sulfonylcyclododecene |
|---|---|
| PubChem CID | 134942172 |
| Molecular Formula | C19H28O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (1Z)-1-(4-methylphenyl)sulfonylcyclododecene |
| SMILES | Cc1ccc(S(=O)(=O)/C2=C\CCCCCCCCCC2)cc1 |
| InChI | InChI=1S/C19H28O2S/c1-17-13-15-19(16-14-17)22(20,21)18-11-9-7-5-3-2-4-6-8-10-12-18/h11,13-16H,2-10,12H2,1H3/b18-11- |
| InChIKey | NSRISHARFNEJPJ-WQRHYEAKSA-N |
| XLogP | 5.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |