C15H21NO2S — CID 57149515
N-[(1R)-1-(cyclohexen-1-yl)ethyl]-4-methylbenzenesulfonamide (PubChem CID 57149515) has the molecular formula C15H21NO2S and a molecular weight of 279.40 g/mol. Its IUPAC name is N-[(1R)-1-(cyclohexen-1-yl)ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R)-1-(cyclohexen-1-yl)ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 57149515 |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | N-[(1R)-1-(cyclohexen-1-yl)ethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](C)C2=CCCCC2)cc1 |
| InChI | InChI=1S/C15H21NO2S/c1-12-8-10-15(11-9-12)19(17,18)16-13(2)14-6-4-3-5-7-14/h6,8-11,13,16H,3-5,7H2,1-2H3/t13-/m1/s1 |
| InChIKey | JGXLGEPLBYDONH-CYBMUJFWSA-N |
| XLogP | 3.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|