C21H22ClNO3S — CID 11058536
N-[(4-chlorophenyl)-(7-oxocyclohepten-1-yl)methyl]-4-methylbenzenesulfonamide (PubChem CID 11058536) has the molecular formula C21H22ClNO3S and a molecular weight of 403.93 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-(7-oxocyclohepten-1-yl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(4-chlorophenyl)-(7-oxocyclohepten-1-yl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11058536 |
| Molecular Formula | C21H22ClNO3S |
| Molecular Weight | 403.93 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | N-[(4-chlorophenyl)-(7-oxocyclohepten-1-yl)methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C2=CCCCCC2=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H22ClNO3S/c1-15-7-13-18(14-8-15)27(25,26)23-21(16-9-11-17(22)12-10-16)19-5-3-2-4-6-20(19)24/h5,7-14,21,23H,2-4,6H2,1H3 |
| InChIKey | KZKYDEDLOVMMDK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.93 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |