C22H25NO3S — CID 101213725
4-methyl-N-[[(1Z)-8-oxocycloocten-1-yl]-phenylmethyl]benzenesulfonamide (PubChem CID 101213725) has the molecular formula C22H25NO3S and a molecular weight of 383.51 g/mol. Its IUPAC name is 4-methyl-N-[[(1Z)-8-oxocycloocten-1-yl]-phenylmethyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[[(1Z)-8-oxocycloocten-1-yl]-phenylmethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 101213725 |
| Molecular Formula | C22H25NO3S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 4-methyl-N-[[(1Z)-8-oxocycloocten-1-yl]-phenylmethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(/C2=C/CCCCCC2=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H25NO3S/c1-17-13-15-19(16-14-17)27(25,26)23-22(18-9-5-4-6-10-18)20-11-7-2-3-8-12-21(20)24/h4-6,9-11,13-16,22-23H,2-3,7-8,12H2,1H3/b20-11+ |
| InChIKey | XSABYPYCIIJPJD-RGVLZGJSSA-N |
| XLogP | 4.47 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |