C21H18F3NO2S — CID 134952770
4-methyl-N-[(S)-phenyl-[3-(trifluoromethyl)phenyl]methyl]benzenesulfonamide (PubChem CID 134952770) has the molecular formula C21H18F3NO2S and a molecular weight of 405.44 g/mol. Its IUPAC name is 4-methyl-N-[(S)-phenyl-[3-(trifluoromethyl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(S)-phenyl-[3-(trifluoromethyl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134952770 |
| Molecular Formula | C21H18F3NO2S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 4-methyl-N-[(S)-phenyl-[3-(trifluoromethyl)phenyl]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](c2ccccc2)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C21H18F3NO2S/c1-15-10-12-19(13-11-15)28(26,27)25-20(16-6-3-2-4-7-16)17-8-5-9-18(14-17)21(22,23)24/h2-14,20,25H,1H3/t20-/m0/s1 |
| InChIKey | HWIVZGHQKJBVJY-FQEVSTJZSA-N |
| XLogP | 5.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |