C16H16F3NO3S — CID 43001289
4-methoxy-N-[1-[3-(trifluoromethyl)phenyl]ethyl]benzenesulfonamide (PubChem CID 43001289) has the molecular formula C16H16F3NO3S and a molecular weight of 359.37 g/mol. Its IUPAC name is 4-methoxy-N-[1-[3-(trifluoromethyl)phenyl]ethyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[1-[3-(trifluoromethyl)phenyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43001289 |
| Molecular Formula | C16H16F3NO3S |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 4-methoxy-N-[1-[3-(trifluoromethyl)phenyl]ethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC(C)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H16F3NO3S/c1-11(12-4-3-5-13(10-12)16(17,18)19)20-24(21,22)15-8-6-14(23-2)7-9-15/h3-11,20H,1-2H3 |
| InChIKey | SFRJVDWSNOQFEW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |