C18H18F3NO5S — CID 55927693
[3-(trifluoromethyl)phenyl]methyl (2S)-2-[(4-methoxyphenyl)sulfonylamino]propanoate (PubChem CID 55927693) has the molecular formula C18H18F3NO5S and a molecular weight of 417.41 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methyl (2S)-2-[(4-methoxyphenyl)sulfonylamino]propanoate.
| Compound Name | [3-(trifluoromethyl)phenyl]methyl (2S)-2-[(4-methoxyphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 55927693 |
| Molecular Formula | C18H18F3NO5S |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methyl (2S)-2-[(4-methoxyphenyl)sulfonylamino]propanoate |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](C)C(=O)OCc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H18F3NO5S/c1-12(22-28(24,25)16-8-6-15(26-2)7-9-16)17(23)27-11-13-4-3-5-14(10-13)18(19,20)21/h3-10,12,22H,11H2,1-2H3/t12-/m0/s1 |
| InChIKey | WXNBNDOWCUOPQG-LBPRGKRZSA-N |
| XLogP | 3.12 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |