C19H20F3NO5S — CID 46689931
[3-(trifluoromethyl)phenyl]methyl 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate (PubChem CID 46689931) has the molecular formula C19H20F3NO5S and a molecular weight of 431.43 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methyl 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate.
| Compound Name | [3-(trifluoromethyl)phenyl]methyl 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 46689931 |
| Molecular Formula | C19H20F3NO5S |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methyl 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate |
| SMILES | COc1ccc(C(=O)OCc2cccc(C(F)(F)F)c2)cc1S(=O)(=O)NC(C)C |
| InChI | InChI=1S/C19H20F3NO5S/c1-12(2)23-29(25,26)17-10-14(7-8-16(17)27-3)18(24)28-11-13-5-4-6-15(9-13)19(20,21)22/h4-10,12,23H,11H2,1-3H3 |
| InChIKey | NSXKOGOIKVDWHT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |