C20H23NO7S — CID 16594814
[4-(2-methoxy-2-oxoethyl)phenyl] 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate (PubChem CID 16594814) has the molecular formula C20H23NO7S and a molecular weight of 421.47 g/mol. Its IUPAC name is [4-(2-methoxy-2-oxoethyl)phenyl] 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate.
| Compound Name | [4-(2-methoxy-2-oxoethyl)phenyl] 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 16594814 |
| Molecular Formula | C20H23NO7S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | [4-(2-methoxy-2-oxoethyl)phenyl] 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate |
| SMILES | COC(=O)Cc1ccc(OC(=O)c2ccc(OC)c(S(=O)(=O)NC(C)C)c2)cc1 |
| InChI | InChI=1S/C20H23NO7S/c1-13(2)21-29(24,25)18-12-15(7-10-17(18)26-3)20(23)28-16-8-5-14(6-9-16)11-19(22)27-4/h5-10,12-13,21H,11H2,1-4H3 |
| InChIKey | KDYDSOOPWFTESW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|