C25H26N2O7S — CID 42984956
[2-oxo-2-(4-phenoxyanilino)ethyl] 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate (PubChem CID 42984956) has the molecular formula C25H26N2O7S and a molecular weight of 498.56 g/mol. Its IUPAC name is [2-oxo-2-(4-phenoxyanilino)ethyl] 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 42984956 |
| Molecular Formula | C25H26N2O7S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2ccc(Oc3ccccc3)cc2)cc1S(=O)(=O)NC(C)C |
| InChI | InChI=1S/C25H26N2O7S/c1-17(2)27-35(30,31)23-15-18(9-14-22(23)32-3)25(29)33-16-24(28)26-19-10-12-21(13-11-19)34-20-7-5-4-6-8-20/h4-15,17,27H,16H2,1-3H3,(H,26,28) |
| InChIKey | FUQWSEQNGUSKSG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |