C22H18N2O8S — CID 2620623
[2-oxo-2-(4-phenoxyanilino)ethyl] 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 2620623) has the molecular formula C22H18N2O8S and a molecular weight of 470.46 g/mol. Its IUPAC name is [2-oxo-2-(4-phenoxyanilino)ethyl] 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 2620623 |
| Molecular Formula | C22H18N2O8S |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | CS(=O)(=O)c1ccc(C(=O)OCC(=O)Nc2ccc(Oc3ccccc3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H18N2O8S/c1-33(29,30)20-12-7-15(13-19(20)24(27)28)22(26)31-14-21(25)23-16-8-10-18(11-9-16)32-17-5-3-2-4-6-17/h2-13H,14H2,1H3,(H,23,25) |
| InChIKey | DFYCOCUSIOYJHM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|