C19H20N4O6 — CID 7262057
[2-(4-acetamidoanilino)-2-oxoethyl] 4-(dimethylamino)-3-nitrobenzoate (PubChem CID 7262057) has the molecular formula C19H20N4O6 and a molecular weight of 400.39 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl] 4-(dimethylamino)-3-nitrobenzoate.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl] 4-(dimethylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 7262057 |
| Molecular Formula | C19H20N4O6 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl] 4-(dimethylamino)-3-nitrobenzoate |
| SMILES | CC(=O)Nc1ccc(NC(=O)COC(=O)c2ccc(N(C)C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H20N4O6/c1-12(24)20-14-5-7-15(8-6-14)21-18(25)11-29-19(26)13-4-9-16(22(2)3)17(10-13)23(27)28/h4-10H,11H2,1-3H3,(H,20,24)(H,21,25) |
| InChIKey | LYTWONUMJMXXBW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|