C17H14F3N3O5 — CID 7262000
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 4-(dimethylamino)-3-nitrobenzoate (PubChem CID 7262000) has the molecular formula C17H14F3N3O5 and a molecular weight of 397.31 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 4-(dimethylamino)-3-nitrobenzoate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 4-(dimethylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 7262000 |
| Molecular Formula | C17H14F3N3O5 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 4-(dimethylamino)-3-nitrobenzoate |
| SMILES | CN(C)c1ccc(C(=O)OCC(=O)Nc2ccc(F)c(F)c2F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14F3N3O5/c1-22(2)12-6-3-9(7-13(12)23(26)27)17(25)28-8-14(24)21-11-5-4-10(18)15(19)16(11)20/h3-7H,8H2,1-2H3,(H,21,24) |
| InChIKey | CAAMSLCAWVNBSB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|