C20H20F3NO6S — CID 41121857
[2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl] 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate (PubChem CID 41121857) has the molecular formula C20H20F3NO6S and a molecular weight of 459.44 g/mol. Its IUPAC name is [2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl] 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl] 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 41121857 |
| Molecular Formula | C20H20F3NO6S |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | [2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl] 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)c2cccc(C(F)(F)F)c2)cc1S(=O)(=O)NC(C)C |
| InChI | InChI=1S/C20H20F3NO6S/c1-12(2)24-31(27,28)18-10-14(7-8-17(18)29-3)19(26)30-11-16(25)13-5-4-6-15(9-13)20(21,22)23/h4-10,12,24H,11H2,1-3H3 |
| InChIKey | ZHOFMDUQFIUJIF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |