C23H25NO7S — CID 41121739
(6,7-dimethyl-2-oxochromen-4-yl)methyl 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate (PubChem CID 41121739) has the molecular formula C23H25NO7S and a molecular weight of 459.52 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 41121739 |
| Molecular Formula | C23H25NO7S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 4-methoxy-3-(propan-2-ylsulfamoyl)benzoate |
| SMILES | COc1ccc(C(=O)OCc2cc(=O)oc3cc(C)c(C)cc23)cc1S(=O)(=O)NC(C)C |
| InChI | InChI=1S/C23H25NO7S/c1-13(2)24-32(27,28)21-10-16(6-7-19(21)29-5)23(26)30-12-17-11-22(25)31-20-9-15(4)14(3)8-18(17)20/h6-11,13,24H,12H2,1-5H3 |
| InChIKey | VSFQYFKRNQZVTQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|