C19H24O3S — CID 132600200
1-(cyclohexen-1-yl)-4-methyl-2-(4-methylphenyl)sulfonylpenta-2,3-dien-1-ol (PubChem CID 132600200) has the molecular formula C19H24O3S and a molecular weight of 332.47 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-4-methyl-2-(4-methylphenyl)sulfonylpenta-2,3-dien-1-ol.
| Compound Name | 1-(cyclohexen-1-yl)-4-methyl-2-(4-methylphenyl)sulfonylpenta-2,3-dien-1-ol |
|---|---|
| PubChem CID | 132600200 |
| Molecular Formula | C19H24O3S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 1-(cyclohexen-1-yl)-4-methyl-2-(4-methylphenyl)sulfonylpenta-2,3-dien-1-ol |
| SMILES | CC(C)=C=C(C(O)C1=CCCCC1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H24O3S/c1-14(2)13-18(19(20)16-7-5-4-6-8-16)23(21,22)17-11-9-15(3)10-12-17/h7,9-12,19-20H,4-6,8H2,1-3H3 |
| InChIKey | SLFCEBBMXQAUBY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|