C18H22F2O5S — CID 139987823
ethyl 3-(cyclohexen-1-yl)-2,2-difluoro-3-(4-methylphenyl)sulfonyloxypropanoate (PubChem CID 139987823) has the molecular formula C18H22F2O5S and a molecular weight of 388.43 g/mol. Its IUPAC name is ethyl 3-(cyclohexen-1-yl)-2,2-difluoro-3-(4-methylphenyl)sulfonyloxypropanoate.
| Compound Name | ethyl 3-(cyclohexen-1-yl)-2,2-difluoro-3-(4-methylphenyl)sulfonyloxypropanoate |
|---|---|
| PubChem CID | 139987823 |
| Molecular Formula | C18H22F2O5S |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | ethyl 3-(cyclohexen-1-yl)-2,2-difluoro-3-(4-methylphenyl)sulfonyloxypropanoate |
| SMILES | CCOC(=O)C(F)(F)C(OS(=O)(=O)c1ccc(C)cc1)C1=CCCCC1 |
| InChI | InChI=1S/C18H22F2O5S/c1-3-24-17(21)18(19,20)16(14-7-5-4-6-8-14)25-26(22,23)15-11-9-13(2)10-12-15/h7,9-12,16H,3-6,8H2,1-2H3 |
| InChIKey | KGOUHXXWWJKGSU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|