C13H14O3S — CID 135393625
3-(4-methylphenyl)sulfonylcyclohex-2-en-1-one (PubChem CID 135393625) has the molecular formula C13H14O3S and a molecular weight of 250.32 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfonylcyclohex-2-en-1-one.
| Compound Name | 3-(4-methylphenyl)sulfonylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135393625 |
| Molecular Formula | C13H14O3S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 3-(4-methylphenyl)sulfonylcyclohex-2-en-1-one |
| SMILES | Cc1ccc(S(=O)(=O)C2=CC(=O)CCC2)cc1 |
| InChI | InChI=1S/C13H14O3S/c1-10-5-7-12(8-6-10)17(15,16)13-4-2-3-11(14)9-13/h5-9H,2-4H2,1H3 |
| InChIKey | DVTONZMCZGWGRG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |