C13H14O2S — CID 16754963
1-cyclohexa-1,4-dien-1-ylsulfonyl-4-methylbenzene (PubChem CID 16754963) has the molecular formula C13H14O2S and a molecular weight of 234.32 g/mol. Its IUPAC name is 1-cyclohexa-1,4-dien-1-ylsulfonyl-4-methylbenzene.
| Compound Name | 1-cyclohexa-1,4-dien-1-ylsulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 16754963 |
| Molecular Formula | C13H14O2S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 1-cyclohexa-1,4-dien-1-ylsulfonyl-4-methylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)C2=CCC=CC2)cc1 |
| InChI | InChI=1S/C13H14O2S/c1-11-7-9-13(10-8-11)16(14,15)12-5-3-2-4-6-12/h2-3,6-10H,4-5H2,1H3 |
| InChIKey | DOJJDMPMMVYUIN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|