C10H11FO3S — CID 175032212
3-fluoroprop-2-enyl 4-methylbenzenesulfonate (PubChem CID 175032212) has the molecular formula C10H11FO3S and a molecular weight of 230.26 g/mol. Its IUPAC name is 3-fluoroprop-2-enyl 4-methylbenzenesulfonate.
| Compound Name | 3-fluoroprop-2-enyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 175032212 |
| Molecular Formula | C10H11FO3S |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 3-fluoroprop-2-enyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC=CF)cc1 |
| InChI | InChI=1S/C10H11FO3S/c1-9-3-5-10(6-4-9)15(12,13)14-8-2-7-11/h2-7H,8H2,1H3 |
| InChIKey | CEXXCYYQHAAYAR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|