C15H19NO4S — CID 138483575
[(2Z,4E)-4-(methylcarbamoyl)hexa-2,4-dienyl] 4-methylbenzenesulfonate (PubChem CID 138483575) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is [(2Z,4E)-4-(methylcarbamoyl)hexa-2,4-dienyl] 4-methylbenzenesulfonate.
| Compound Name | [(2Z,4E)-4-(methylcarbamoyl)hexa-2,4-dienyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 138483575 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | [(2Z,4E)-4-(methylcarbamoyl)hexa-2,4-dienyl] 4-methylbenzenesulfonate |
| SMILES | C/C=C(\C=C/COS(=O)(=O)c1ccc(C)cc1)C(=O)NC |
| InChI | InChI=1S/C15H19NO4S/c1-4-13(15(17)16-3)6-5-11-20-21(18,19)14-9-7-12(2)8-10-14/h4-10H,11H2,1-3H3,(H,16,17)/b6-5-,13-4+ |
| InChIKey | GHMGDXBDKDWITC-BDNXDWBHSA-N |
| XLogP | 1.95 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|