C12H15F3O3S — CID 177440983
[3-fluoro-2,2-bis(fluoromethyl)propyl] 4-methylbenzenesulfonate (PubChem CID 177440983) has the molecular formula C12H15F3O3S and a molecular weight of 296.31 g/mol. Its IUPAC name is [3-fluoro-2,2-bis(fluoromethyl)propyl] 4-methylbenzenesulfonate.
| Compound Name | [3-fluoro-2,2-bis(fluoromethyl)propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 177440983 |
| Molecular Formula | C12H15F3O3S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | [3-fluoro-2,2-bis(fluoromethyl)propyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(CF)(CF)CF)cc1 |
| InChI | InChI=1S/C12H15F3O3S/c1-10-2-4-11(5-3-10)19(16,17)18-9-12(6-13,7-14)8-15/h2-5H,6-9H2,1H3 |
| InChIKey | DLRRVSBIMZXKRY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|