C12H15NO3S — CID 168756659
(2-isocyano-2-methylpropyl) 4-methylbenzenesulfonate (PubChem CID 168756659) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is (2-isocyano-2-methylpropyl) 4-methylbenzenesulfonate.
| Compound Name | (2-isocyano-2-methylpropyl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 168756659 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | (2-isocyano-2-methylpropyl) 4-methylbenzenesulfonate |
| SMILES | [C-]#[N+]C(C)(C)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H15NO3S/c1-10-5-7-11(8-6-10)17(14,15)16-9-12(2,3)13-4/h5-8H,9H2,1-3H3 |
| InChIKey | YSAZZHMMBOPCEX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|