C23H32O8S2 — CID 90346498
[2-(2-hydroxypropan-2-yloxymethyl)-2-[(4-methylphenyl)sulfonyloxymethyl]butyl] 4-methylbenzenesulfonate (PubChem CID 90346498) has the molecular formula C23H32O8S2 and a molecular weight of 500.64 g/mol. Its IUPAC name is [2-(2-hydroxypropan-2-yloxymethyl)-2-[(4-methylphenyl)sulfonyloxymethyl]butyl] 4-methylbenzenesulfonate.
| Compound Name | [2-(2-hydroxypropan-2-yloxymethyl)-2-[(4-methylphenyl)sulfonyloxymethyl]butyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90346498 |
| Molecular Formula | C23H32O8S2 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | [2-(2-hydroxypropan-2-yloxymethyl)-2-[(4-methylphenyl)sulfonyloxymethyl]butyl] 4-methylbenzenesulfonate |
| SMILES | CCC(COC(C)(C)O)(COS(=O)(=O)c1ccc(C)cc1)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H32O8S2/c1-6-23(15-29-22(4,5)24,16-30-32(25,26)20-11-7-18(2)8-12-20)17-31-33(27,28)21-13-9-19(3)10-14-21/h7-14,24H,6,15-17H2,1-5H3 |
| InChIKey | IXIKFFTVGHAXHY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|