C14H13NO8S — CID 91589145
4-(4-methylphenyl)sulfonyloxy-6-oxo-2,3-dihydropyridine-1,2-dicarboxylic acid (PubChem CID 91589145) has the molecular formula C14H13NO8S and a molecular weight of 355.32 g/mol. Its IUPAC name is 4-(4-methylphenyl)sulfonyloxy-6-oxo-2,3-dihydropyridine-1,2-dicarboxylic acid.
| Compound Name | 4-(4-methylphenyl)sulfonyloxy-6-oxo-2,3-dihydropyridine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 91589145 |
| Molecular Formula | C14H13NO8S |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 4-(4-methylphenyl)sulfonyloxy-6-oxo-2,3-dihydropyridine-1,2-dicarboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)OC2=CC(=O)N(C(=O)O)C(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C14H13NO8S/c1-8-2-4-10(5-3-8)24(21,22)23-9-6-11(13(17)18)15(14(19)20)12(16)7-9/h2-5,7,11H,6H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | KSWLUAQPZXJBMC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|