C14H14N2O7S — CID 91087239
(3S,5S)-1-(4-methylphenyl)sulfonyl-7-oxo-1,6-diazaspiro[2.4]heptane-5,6-dicarboxylic acid (PubChem CID 91087239) has the molecular formula C14H14N2O7S and a molecular weight of 354.34 g/mol. Its IUPAC name is (3S,5S)-1-(4-methylphenyl)sulfonyl-7-oxo-1,6-diazaspiro[2.4]heptane-5,6-dicarboxylic acid.
| Compound Name | (3S,5S)-1-(4-methylphenyl)sulfonyl-7-oxo-1,6-diazaspiro[2.4]heptane-5,6-dicarboxylic acid |
|---|---|
| PubChem CID | 91087239 |
| Molecular Formula | C14H14N2O7S |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | (3S,5S)-1-(4-methylphenyl)sulfonyl-7-oxo-1,6-diazaspiro[2.4]heptane-5,6-dicarboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@]23C[C@@H](C(=O)O)N(C(=O)O)C3=O)cc1 |
| InChI | InChI=1S/C14H14N2O7S/c1-8-2-4-9(5-3-8)24(22,23)15-7-14(15)6-10(11(17)18)16(12(14)19)13(20)21/h2-5,10H,6-7H2,1H3,(H,17,18)(H,20,21)/t10-,14-,15?/m0/s1 |
| InChIKey | CXLAVOSAKRYPKU-BNVJPMHFSA-N |
| XLogP | 0.10 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|