C15H24N2O2S — CID 82251742
2,2,5,5-tetramethyl-1-(4-methylphenyl)sulfonylpiperazine (PubChem CID 82251742) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-1-(4-methylphenyl)sulfonylpiperazine.
| Compound Name | 2,2,5,5-tetramethyl-1-(4-methylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 82251742 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2,2,5,5-tetramethyl-1-(4-methylphenyl)sulfonylpiperazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C)(C)NCC2(C)C)cc1 |
| InChI | InChI=1S/C15H24N2O2S/c1-12-6-8-13(9-7-12)20(18,19)17-11-14(2,3)16-10-15(17,4)5/h6-9,16H,10-11H2,1-5H3 |
| InChIKey | QGUAJUPVKBQEHV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |