C32H36N4O8S4Si — CID 100926262
1,4,6,9-tetrakis-(4-methylphenyl)sulfonyl-1,4,6,9-tetraza-5-silaspiro[4.4]nonane (PubChem CID 100926262) has the molecular formula C32H36N4O8S4Si and a molecular weight of 761.01 g/mol. Its IUPAC name is 1,4,6,9-tetrakis-(4-methylphenyl)sulfonyl-1,4,6,9-tetraza-5-silaspiro[4.4]nonane.
| Compound Name | 1,4,6,9-tetrakis-(4-methylphenyl)sulfonyl-1,4,6,9-tetraza-5-silaspiro[4.4]nonane |
|---|---|
| PubChem CID | 100926262 |
| Molecular Formula | C32H36N4O8S4Si |
| Molecular Weight | 761.01 g/mol |
| Exact Mass | 760.12 |
| IUPAC Name | 1,4,6,9-tetrakis-(4-methylphenyl)sulfonyl-1,4,6,9-tetraza-5-silaspiro[4.4]nonane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(S(=O)(=O)c3ccc(C)cc3)[Si]23N(S(=O)(=O)c2ccc(C)cc2)CCN3S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C32H36N4O8S4Si/c1-25-5-13-29(14-6-25)45(37,38)33-21-22-34(46(39,40)30-15-7-26(2)8-16-30)49(33)35(47(41,42)31-17-9-27(3)10-18-31)23-24-36(49)48(43,44)32-19-11-28(4)12-20-32/h5-20H,21-24H2,1-4H3 |
| InChIKey | ZRXTWEBQHJQFAY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 149.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.01 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|