C21H27N3O6S2 — CID 59079719
N-hydroxy-5,5-dimethyl-1,3-bis-(4-methylphenyl)sulfonyl-1,3-diazinane-2-carboxamide (PubChem CID 59079719) has the molecular formula C21H27N3O6S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is N-hydroxy-5,5-dimethyl-1,3-bis-(4-methylphenyl)sulfonyl-1,3-diazinane-2-carboxamide.
| Compound Name | N-hydroxy-5,5-dimethyl-1,3-bis-(4-methylphenyl)sulfonyl-1,3-diazinane-2-carboxamide |
|---|---|
| PubChem CID | 59079719 |
| Molecular Formula | C21H27N3O6S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | N-hydroxy-5,5-dimethyl-1,3-bis-(4-methylphenyl)sulfonyl-1,3-diazinane-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C)(C)CN(S(=O)(=O)c3ccc(C)cc3)C2C(=O)NO)cc1 |
| InChI | InChI=1S/C21H27N3O6S2/c1-15-5-9-17(10-6-15)31(27,28)23-13-21(3,4)14-24(20(23)19(25)22-26)32(29,30)18-11-7-16(2)8-12-18/h5-12,20,26H,13-14H2,1-4H3,(H,22,25) |
| InChIKey | BJNCGBZEAUCHCG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|