C16H21BN2O6S — CID 59205747
[(5S)-5-ethoxycarbonyl-1-(4-methylphenyl)sulfonyl-7-oxo-1,6-diazaspiro[2.4]heptan-6-yl]-methylborinic acid (PubChem CID 59205747) has the molecular formula C16H21BN2O6S and a molecular weight of 380.23 g/mol. Its IUPAC name is [(5S)-5-ethoxycarbonyl-1-(4-methylphenyl)sulfonyl-7-oxo-1,6-diazaspiro[2.4]heptan-6-yl]-methylborinic acid.
| Compound Name | [(5S)-5-ethoxycarbonyl-1-(4-methylphenyl)sulfonyl-7-oxo-1,6-diazaspiro[2.4]heptan-6-yl]-methylborinic acid |
|---|---|
| PubChem CID | 59205747 |
| Molecular Formula | C16H21BN2O6S |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | [(5S)-5-ethoxycarbonyl-1-(4-methylphenyl)sulfonyl-7-oxo-1,6-diazaspiro[2.4]heptan-6-yl]-methylborinic acid |
| SMILES | CCOC(=O)[C@@H]1CC2(CN2S(=O)(=O)c2ccc(C)cc2)C(=O)N1B(C)O |
| InChI | InChI=1S/C16H21BN2O6S/c1-4-25-14(20)13-9-16(15(21)19(13)17(3)22)10-18(16)26(23,24)12-7-5-11(2)6-8-12/h5-8,13,22H,4,9-10H2,1-3H3/t13-,16?,18?/m0/s1 |
| InChIKey | QEBSZWKUJOVNQM-BELGNNRLSA-N |
| XLogP | 0.01 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|