C17H23NO5S2 — CID 24859643
ethyl 3-[(2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carbonyl]sulfanylpropanoate (PubChem CID 24859643) has the molecular formula C17H23NO5S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is ethyl 3-[(2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carbonyl]sulfanylpropanoate.
| Compound Name | ethyl 3-[(2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carbonyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 24859643 |
| Molecular Formula | C17H23NO5S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | ethyl 3-[(2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carbonyl]sulfanylpropanoate |
| SMILES | CCOC(=O)CCSC(=O)[C@@H]1CCCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H23NO5S2/c1-3-23-16(19)10-12-24-17(20)15-5-4-11-18(15)25(21,22)14-8-6-13(2)7-9-14/h6-9,15H,3-5,10-12H2,1-2H3/t15-/m0/s1 |
| InChIKey | MLFODWKXXGHJHV-HNNXBMFYSA-N |
| XLogP | 2.36 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|