C23H29NO4S2 — CID 54041098
S-[3-(4-methoxyphenyl)propyl] (2S)-1-(4-methylphenyl)sulfonylpiperidine-2-carbothioate (PubChem CID 54041098) has the molecular formula C23H29NO4S2 and a molecular weight of 447.62 g/mol. Its IUPAC name is S-[3-(4-methoxyphenyl)propyl] (2S)-1-(4-methylphenyl)sulfonylpiperidine-2-carbothioate.
| Compound Name | S-[3-(4-methoxyphenyl)propyl] (2S)-1-(4-methylphenyl)sulfonylpiperidine-2-carbothioate |
|---|---|
| PubChem CID | 54041098 |
| Molecular Formula | C23H29NO4S2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | S-[3-(4-methoxyphenyl)propyl] (2S)-1-(4-methylphenyl)sulfonylpiperidine-2-carbothioate |
| SMILES | COc1ccc(CCCSC(=O)[C@@H]2CCCCN2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H29NO4S2/c1-18-8-14-21(15-9-18)30(26,27)24-16-4-3-7-22(24)23(25)29-17-5-6-19-10-12-20(28-2)13-11-19/h8-15,22H,3-7,16-17H2,1-2H3/t22-/m0/s1 |
| InChIKey | LMKAJFAXDKONLW-QFIPXVFZSA-N |
| XLogP | 4.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|