C34H34NO5PS — CID 10817369
ethyl 3-[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]-3-oxo-2-(triphenyl-λ5-phosphanylidene)propanoate (PubChem CID 10817369) has the molecular formula C34H34NO5PS and a molecular weight of 599.69 g/mol. Its IUPAC name is ethyl 3-[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]-3-oxo-2-(triphenyl-λ5-phosphanylidene)propanoate.
| Compound Name | ethyl 3-[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]-3-oxo-2-(triphenyl-λ5-phosphanylidene)propanoate |
|---|---|
| PubChem CID | 10817369 |
| Molecular Formula | C34H34NO5PS |
| Molecular Weight | 599.69 g/mol |
| Exact Mass | 599.19 |
| IUPAC Name | ethyl 3-[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]-3-oxo-2-(triphenyl-λ5-phosphanylidene)propanoate |
| SMILES | CCOC(=O)C(C(=O)[C@@H]1CCCN1S(=O)(=O)c1ccc(C)cc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H34NO5PS/c1-3-40-34(37)33(32(36)31-20-13-25-35(31)42(38,39)30-23-21-26(2)22-24-30)41(27-14-7-4-8-15-27,28-16-9-5-10-17-28)29-18-11-6-12-19-29/h4-12,14-19,21-24,31H,3,13,20,25H2,1-2H3/t31-/m0/s1 |
| InChIKey | BTXFACAJKABUCE-HKBQPEDESA-N |
| XLogP | 4.45 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.69 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|