C20H23NO4S2 — CID 70017121
ethyl (2S)-1-(4-methylphenyl)sulfonyl-4-phenylsulfanylpyrrolidine-2-carboxylate (PubChem CID 70017121) has the molecular formula C20H23NO4S2 and a molecular weight of 405.54 g/mol. Its IUPAC name is ethyl (2S)-1-(4-methylphenyl)sulfonyl-4-phenylsulfanylpyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S)-1-(4-methylphenyl)sulfonyl-4-phenylsulfanylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 70017121 |
| Molecular Formula | C20H23NO4S2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | ethyl (2S)-1-(4-methylphenyl)sulfonyl-4-phenylsulfanylpyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC(Sc2ccccc2)CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H23NO4S2/c1-3-25-20(22)19-13-17(26-16-7-5-4-6-8-16)14-21(19)27(23,24)18-11-9-15(2)10-12-18/h4-12,17,19H,3,13-14H2,1-2H3/t17?,19-/m0/s1 |
| InChIKey | FTAZDJSTQSNQDG-NNBQYGFHSA-N |
| XLogP | 3.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |