C21H23NO4S — CID 162412511
ethyl 4-benzyl-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole-2-carboxylate (PubChem CID 162412511) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is ethyl 4-benzyl-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole-2-carboxylate.
| Compound Name | ethyl 4-benzyl-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 162412511 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | ethyl 4-benzyl-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole-2-carboxylate |
| SMILES | CCOC(=O)C1C=C(Cc2ccccc2)CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H23NO4S/c1-3-26-21(23)20-14-18(13-17-7-5-4-6-8-17)15-22(20)27(24,25)19-11-9-16(2)10-12-19/h4-12,14,20H,3,13,15H2,1-2H3 |
| InChIKey | MJNRKNFVAPVSSZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|