C26H32N2O5S — CID 138391907
ethyl (3R,3aS,7aR)-7a-acetyl-5-benzyl-2-(4-methylphenyl)sulfonyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridine-3-carboxylate (PubChem CID 138391907) has the molecular formula C26H32N2O5S and a molecular weight of 484.62 g/mol. Its IUPAC name is ethyl (3R,3aS,7aR)-7a-acetyl-5-benzyl-2-(4-methylphenyl)sulfonyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridine-3-carboxylate.
| Compound Name | ethyl (3R,3aS,7aR)-7a-acetyl-5-benzyl-2-(4-methylphenyl)sulfonyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 138391907 |
| Molecular Formula | C26H32N2O5S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | ethyl (3R,3aS,7aR)-7a-acetyl-5-benzyl-2-(4-methylphenyl)sulfonyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2CN(Cc3ccccc3)CC[C@]2(C(C)=O)CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H32N2O5S/c1-4-33-25(30)24-23-17-27(16-21-8-6-5-7-9-21)15-14-26(23,20(3)29)18-28(24)34(31,32)22-12-10-19(2)11-13-22/h5-13,23-24H,4,14-18H2,1-3H3/t23-,24+,26+/m0/s1 |
| InChIKey | RTPLHFAPYQQRFA-BFLUCZKCSA-N |
| XLogP | 3.03 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |