C25H31N3O3 — CID 91670674
ethyl (3S,3aR,7aS)-7a-acetamido-5-benzyl-3-phenyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridine-2-carboxylate (PubChem CID 91670674) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is ethyl (3S,3aR,7aS)-7a-acetamido-5-benzyl-3-phenyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridine-2-carboxylate.
| Compound Name | ethyl (3S,3aR,7aS)-7a-acetamido-5-benzyl-3-phenyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 91670674 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | ethyl (3S,3aR,7aS)-7a-acetamido-5-benzyl-3-phenyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridine-2-carboxylate |
| SMILES | CCOC(=O)N1C[C@]2(NC(C)=O)CCN(Cc3ccccc3)C[C@@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H31N3O3/c1-3-31-24(30)28-18-25(26-19(2)29)14-15-27(16-20-10-6-4-7-11-20)17-22(25)23(28)21-12-8-5-9-13-21/h4-13,22-23H,3,14-18H2,1-2H3,(H,26,29)/t22-,23-,25-/m1/s1 |
| InChIKey | NTKAEMXYUGWFRO-VDKIKQQVSA-N |
| XLogP | 3.60 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |