C27H34N4O4 — CID 129454176
2-[(3S,3aR,7aS)-7a-acetamido-2-acetyl-3-phenyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-N-(2-phenoxyethyl)acetamide (PubChem CID 129454176) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is 2-[(3S,3aR,7aS)-7a-acetamido-2-acetyl-3-phenyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-[(3S,3aR,7aS)-7a-acetamido-2-acetyl-3-phenyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 129454176 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 2-[(3S,3aR,7aS)-7a-acetamido-2-acetyl-3-phenyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-N-(2-phenoxyethyl)acetamide |
| SMILES | CC(=O)N[C@@]12CCN(CC(=O)NCCOc3ccccc3)C[C@@H]1[C@@H](c1ccccc1)N(C(C)=O)C2 |
| InChI | InChI=1S/C27H34N4O4/c1-20(32)29-27-13-15-30(18-25(34)28-14-16-35-23-11-7-4-8-12-23)17-24(27)26(31(19-27)21(2)33)22-9-5-3-6-10-22/h3-12,24,26H,13-19H2,1-2H3,(H,28,34)(H,29,32)/t24-,26-,27-/m1/s1 |
| InChIKey | CZMLZXSVLTWVAN-ZRJLEYOISA-N |
| XLogP | 1.98 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|