C22H31N3O2 — CID 110137790
N-[(3S,3aR,7aS)-2-acetyl-5-(cyclobutylmethyl)-3-phenyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-7a-yl]acetamide (PubChem CID 110137790) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is N-[(3S,3aR,7aS)-2-acetyl-5-(cyclobutylmethyl)-3-phenyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-7a-yl]acetamide.
| Compound Name | N-[(3S,3aR,7aS)-2-acetyl-5-(cyclobutylmethyl)-3-phenyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-7a-yl]acetamide |
|---|---|
| PubChem CID | 110137790 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | N-[(3S,3aR,7aS)-2-acetyl-5-(cyclobutylmethyl)-3-phenyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-7a-yl]acetamide |
| SMILES | CC(=O)N[C@@]12CCN(CC3CCC3)C[C@@H]1[C@@H](c1ccccc1)N(C(C)=O)C2 |
| InChI | InChI=1S/C22H31N3O2/c1-16(26)23-22-11-12-24(13-18-7-6-8-18)14-20(22)21(25(15-22)17(2)27)19-9-4-3-5-10-19/h3-5,9-10,18,20-21H,6-8,11-15H2,1-2H3,(H,23,26)/t20-,21-,22-/m1/s1 |
| InChIKey | NRHPSOCRVOUCKO-YPAWHYETSA-N |
| XLogP | 2.59 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |