C21H27BN3O6S+ — CID 59205769
[(3S,5R)-5-ethoxycarbonyl-3-[(4-methylphenyl)sulfonylamino]-2-oxo-3-(pyridin-1-ium-1-ylmethyl)pyrrolidin-1-yl]-methylborinic acid (PubChem CID 59205769) has the molecular formula C21H27BN3O6S+ and a molecular weight of 460.34 g/mol. Its IUPAC name is [(3S,5R)-5-ethoxycarbonyl-3-[(4-methylphenyl)sulfonylamino]-2-oxo-3-(pyridin-1-ium-1-ylmethyl)pyrrolidin-1-yl]-methylborinic acid.
| Compound Name | [(3S,5R)-5-ethoxycarbonyl-3-[(4-methylphenyl)sulfonylamino]-2-oxo-3-(pyridin-1-ium-1-ylmethyl)pyrrolidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 59205769 |
| Molecular Formula | C21H27BN3O6S+ |
| Molecular Weight | 460.34 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | [(3S,5R)-5-ethoxycarbonyl-3-[(4-methylphenyl)sulfonylamino]-2-oxo-3-(pyridin-1-ium-1-ylmethyl)pyrrolidin-1-yl]-methylborinic acid |
| SMILES | CCOC(=O)[C@H]1C[C@@](C[n+]2ccccc2)(NS(=O)(=O)c2ccc(C)cc2)C(=O)N1B(C)O |
| InChI | InChI=1S/C21H27BN3O6S/c1-4-31-19(26)18-14-21(20(27)25(18)22(3)28,15-24-12-6-5-7-13-24)23-32(29,30)17-10-8-16(2)9-11-17/h5-13,18,23,28H,4,14-15H2,1-3H3/q+1/t18-,21+/m1/s1 |
| InChIKey | VSOFDECKYLILMK-NQIIRXRSSA-N |
| XLogP | 0.27 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.34 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|