C20H26N2O7S — CID 89319904
6-O-tert-butyl 5-O-ethyl (3S,5R)-1-(4-methylphenyl)sulfonyl-7-oxo-1,6-diazaspiro[2.4]heptane-5,6-dicarboxylate (PubChem CID 89319904) has the molecular formula C20H26N2O7S and a molecular weight of 438.50 g/mol. Its IUPAC name is 6-O-tert-butyl 5-O-ethyl (3S,5R)-1-(4-methylphenyl)sulfonyl-7-oxo-1,6-diazaspiro[2.4]heptane-5,6-dicarboxylate.
| Compound Name | 6-O-tert-butyl 5-O-ethyl (3S,5R)-1-(4-methylphenyl)sulfonyl-7-oxo-1,6-diazaspiro[2.4]heptane-5,6-dicarboxylate |
|---|---|
| PubChem CID | 89319904 |
| Molecular Formula | C20H26N2O7S |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 6-O-tert-butyl 5-O-ethyl (3S,5R)-1-(4-methylphenyl)sulfonyl-7-oxo-1,6-diazaspiro[2.4]heptane-5,6-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@]2(CN2S(=O)(=O)c2ccc(C)cc2)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H26N2O7S/c1-6-28-16(23)15-11-20(17(24)22(15)18(25)29-19(3,4)5)12-21(20)30(26,27)14-9-7-13(2)8-10-14/h7-10,15H,6,11-12H2,1-5H3/t15-,20+,21?/m1/s1 |
| InChIKey | HBMRGGKTELZEKB-GZOQVGHDSA-N |
| XLogP | 1.84 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|