C15H26N2O5 — CID 150704119
ditert-butyl 4-amino-4-methyl-5-oxopyrrolidine-1,2-dicarboxylate (PubChem CID 150704119) has the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. Its IUPAC name is ditert-butyl 4-amino-4-methyl-5-oxopyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl 4-amino-4-methyl-5-oxopyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 150704119 |
| Molecular Formula | C15H26N2O5 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | ditert-butyl 4-amino-4-methyl-5-oxopyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1CC(C)(N)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26N2O5/c1-13(2,3)21-10(18)9-8-15(7,16)11(19)17(9)12(20)22-14(4,5)6/h9H,8,16H2,1-7H3 |
| InChIKey | JMMRAHAGOYAWNS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |