C28H47NO5Si2 — CID 11203417
ditert-butyl (2S)-5-oxo-4,4-bis(4-trimethylsilylbut-3-ynyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 11203417) has the molecular formula C28H47NO5Si2 and a molecular weight of 533.86 g/mol. Its IUPAC name is ditert-butyl (2S)-5-oxo-4,4-bis(4-trimethylsilylbut-3-ynyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S)-5-oxo-4,4-bis(4-trimethylsilylbut-3-ynyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11203417 |
| Molecular Formula | C28H47NO5Si2 |
| Molecular Weight | 533.86 g/mol |
| Exact Mass | 533.30 |
| IUPAC Name | ditert-butyl (2S)-5-oxo-4,4-bis(4-trimethylsilylbut-3-ynyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CC(CCC#C[Si](C)(C)C)(CCC#C[Si](C)(C)C)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H47NO5Si2/c1-26(2,3)33-23(30)22-21-28(17-13-15-19-35(7,8)9,18-14-16-20-36(10,11)12)24(31)29(22)25(32)34-27(4,5)6/h22H,13-14,17-18,21H2,1-12H3/t22-/m0/s1 |
| InChIKey | FBPWWNJKQJOSOX-QFIPXVFZSA-N |
| XLogP | 6.17 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.86 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|