C17H28N2O7 — CID 56602093
1-O-tert-butyl 2-O,4-O-diethyl (2S,4S)-4-(2-aminoethyl)-5-oxopyrrolidine-1,2,4-tricarboxylate (PubChem CID 56602093) has the molecular formula C17H28N2O7 and a molecular weight of 372.42 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O,4-O-diethyl (2S,4S)-4-(2-aminoethyl)-5-oxopyrrolidine-1,2,4-tricarboxylate.
| Compound Name | 1-O-tert-butyl 2-O,4-O-diethyl (2S,4S)-4-(2-aminoethyl)-5-oxopyrrolidine-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 56602093 |
| Molecular Formula | C17H28N2O7 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 1-O-tert-butyl 2-O,4-O-diethyl (2S,4S)-4-(2-aminoethyl)-5-oxopyrrolidine-1,2,4-tricarboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@](CCN)(C(=O)OCC)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H28N2O7/c1-6-24-12(20)11-10-17(8-9-18,14(22)25-7-2)13(21)19(11)15(23)26-16(3,4)5/h11H,6-10,18H2,1-5H3/t11-,17-/m0/s1 |
| InChIKey | XSEQELFOTUCDDY-GTNSWQLSSA-N |
| XLogP | 0.98 |
| TPSA | 125.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|