C20H32ClNO7 — CID 102352512
1-O,4-O-ditert-butyl 2-O-ethyl (2S)-4-(3-chloropropyl)-5-oxopyrrolidine-1,2,4-tricarboxylate (PubChem CID 102352512) has the molecular formula C20H32ClNO7 and a molecular weight of 433.93 g/mol. Its IUPAC name is 1-O,4-O-ditert-butyl 2-O-ethyl (2S)-4-(3-chloropropyl)-5-oxopyrrolidine-1,2,4-tricarboxylate.
| Compound Name | 1-O,4-O-ditert-butyl 2-O-ethyl (2S)-4-(3-chloropropyl)-5-oxopyrrolidine-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 102352512 |
| Molecular Formula | C20H32ClNO7 |
| Molecular Weight | 433.93 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 1-O,4-O-ditert-butyl 2-O-ethyl (2S)-4-(3-chloropropyl)-5-oxopyrrolidine-1,2,4-tricarboxylate |
| SMILES | CCOC(=O)[C@@H]1CC(CCCCl)(C(=O)OC(C)(C)C)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H32ClNO7/c1-8-27-14(23)13-12-20(10-9-11-21,16(25)28-18(2,3)4)15(24)22(13)17(26)29-19(5,6)7/h13H,8-12H2,1-7H3/t13-,20?/m0/s1 |
| InChIKey | IKDGSMJFNICYAY-SZQRVLIRSA-N |
| XLogP | 3.43 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.93 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|