C26H32N2O8 — CID 10864015
2-O-tert-butyl 3-O-ethyl (3R,5R,6E)-9-benzyl-6-(2-methoxy-2-oxoethylidene)-1,10-dioxo-2,9-diazaspiro[4.5]decane-2,3-dicarboxylate (PubChem CID 10864015) has the molecular formula C26H32N2O8 and a molecular weight of 500.55 g/mol. Its IUPAC name is 2-O-tert-butyl 3-O-ethyl (3R,5R,6E)-9-benzyl-6-(2-methoxy-2-oxoethylidene)-1,10-dioxo-2,9-diazaspiro[4.5]decane-2,3-dicarboxylate.
| Compound Name | 2-O-tert-butyl 3-O-ethyl (3R,5R,6E)-9-benzyl-6-(2-methoxy-2-oxoethylidene)-1,10-dioxo-2,9-diazaspiro[4.5]decane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10864015 |
| Molecular Formula | C26H32N2O8 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 2-O-tert-butyl 3-O-ethyl (3R,5R,6E)-9-benzyl-6-(2-methoxy-2-oxoethylidene)-1,10-dioxo-2,9-diazaspiro[4.5]decane-2,3-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@]2(C(=O)N(Cc3ccccc3)CC/C2=C\C(=O)OC)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H32N2O8/c1-6-35-21(30)19-15-26(23(32)28(19)24(33)36-25(2,3)4)18(14-20(29)34-5)12-13-27(22(26)31)16-17-10-8-7-9-11-17/h7-11,14,19H,6,12-13,15-16H2,1-5H3/b18-14+/t19-,26-/m1/s1 |
| InChIKey | SLTGECJDECQHQW-SCUKDVSESA-N |
| XLogP | 2.60 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|